Compound Q&A

What industries use 1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 50715-50-9)?

Answer

1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate
1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate is primarily used in the pharmaceutical industry for the development of novel drugs. It may also be applied in the polymer industry for the synthesis of biomedical polymers, and in the sensor industry for the development of chemical sensors due to its reactivity and functional groups.

About

CAS No 50715-50-9
English Name 1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate
Molecular Formula C17H26N2O8
Molecular Weight 386.4 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C
InChIKey PIITZDSTZQZNQH-JTQLQIEISA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 50715-50-9)?

1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspart...

Compound Q&A

How is 1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 50715-50-9) typically synthesized?

This compound is typically synthesized through a multi-step process involving the protection of the ...

Compound Q&A

What precautions should be taken when handling 1-(2,5-Dioxo-1-pyrrolidinyl) 4-(2-methyl-2-propanyl) N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-aspartate (CAS: 50715-50-9)?

When handling this compound, ensure proper personal protective equipment (PPE) is worn, including gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...