Compound Q&A

What industries use 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5)?

Answer

8-Fluoroquinazoline-2,4(1H,3H)-dione has applications in pharmaceuticals, particularly in the development of novel antifungal agents. It is also used in the synthesis of certain dyes and pigments, and can be employed in the production of materials for sensors and semiconductors.

About

CAS No 959236-96-5

English Name 8-Fluoroquinazoline-2,4(1H,3H)-dione

Molecular Formula C8H5FN2O2

Molecular Weight 180.138 g/mol

SMILES C1=CC2=C(C(=C1)F)NC(=O)NC2=O

InChIKey FWGXKHUKBVXXCD-UHFFFAOYSA-N

Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5)?

8-Fluoroquinazoline-2,4(1H,3H)-dione is a white crystalline solid with a molecular weight of 253.12 ...

Compound Q&A

How is 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5) typically synthesized?

8-Fluoroquinazoline-2,4(1H,3H)-dione can be synthesized through condensation of 8-fluoroquinazoline ...

Compound Q&A

What precautions should be taken when handling 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5)?

When handling 8-Fluoroquinazoline-2,4(1H,3H)-dione, appropriate personal protective equipment (PPE) ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What industries use 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5)?

Answer

About

Related Q&A

What are the physical and chemical properties of 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5)?

How is 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5) typically synthesized?

What precautions should be taken when handling 8-Fluoroquinazoline-2,4(1H,3H)-dione (CAS: 959236-96-5)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shanghai Jixiang Biotechnology Co., Ltd.

Shanghai Bohui Meike Chemical Technology Co., Ltd.

ShenZhenShiRuiJiTe Biotechnology Co Ltd

Leyan Reagents

HePeng （ ShangHai ） Biotechnology Co Ltd

Guangdong Wanzhang Chemical Reagent Co., Ltd.