Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-ylmethyl {15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}carbamate (CAS: 1314378-14-7)?

Answer

9H-Fluoren-9-ylmethyl {15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}carbamate
This compound is a solid with a crystalline form. Its molecular weight is approximately 700 g/mol. It has low solubility in water but is soluble in common organic solvents like dichloromethane and ethanol. It is highly reactive due to the carbamate group and the fluorene ring, making it susceptible to hydrolysis and other chemical transformations.

About

English Name 9H-Fluoren-9-ylmethyl {15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}carbamate
Molecular Formula C30H36N2O10
Molecular Weight 584.62 g/mol
SMILES O=C(ON1C(CCC1=O)=O)CCOCCOCCOCCOCCNC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O
InChIKey NMCTTZZPHFQEQB-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is 9H-Fluoren-9-ylmethyl {15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}carbamate (CAS: 1314378-14-7) typically synthesized?

The compound can be synthesized via a multistep process, starting with fluorene and a pyrrolidine de...

Compound Q&A

What industries use 9H-Fluoren-9-ylmethyl {15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}carbamate (CAS: 1314378-14-7)?

This compound has applications in the pharmaceutical industry for its potential use as a precursor i...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-ylmethyl {15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}carbamate (CAS: 1314378-14-7)?

Handling this compound requires strict safety measures. Use appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...