Compound Q&A

What industries use Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6)?

Answer

Methyl 5-bromo-2-fluorobenzoate
Methyl 5-bromo-2-fluorobenzoate is primarily used in the pharmaceutical industry for the synthesis of various organic compounds and intermediates. It is also utilized in the polymer industry for developing new materials and in the sensor industry for improving sensor performance.

About

CAS No 57381-59-6
English Name Methyl 5-bromo-2-fluorobenzoate
Molecular Formula C8H6BrFO2
Molecular Weight 233.03599999999997 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)F
InChIKey DXOPSTSVRPCTOS-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6)?

Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6) is a crystalline solid at room temperature. Its mo...

Compound Q&A

How is Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6) typically synthesized?

Methyl 5-bromo-2-fluorobenzoate can be synthesized through the bromination of 2-fluorobenzoic acid w...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6)?

When handling Methyl 5-bromo-2-fluorobenzoate, wear appropriate personal protective equipment (PPE) ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...