Compound Q&A

What are the physical and chemical properties of Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6)?

Answer

Methyl 5-bromo-2-fluorobenzoate
Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6) is a crystalline solid at room temperature. Its molecular weight is approximately 226.01 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is reactive and can undergo electrophilic aromatic substitution reactions.

About

CAS No 57381-59-6
English Name Methyl 5-bromo-2-fluorobenzoate
Molecular Formula C8H6BrFO2
Molecular Weight 233.03599999999997 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Br)F
InChIKey DXOPSTSVRPCTOS-UHFFFAOYSA-N
Last Updated: 2025-10-29 13:16

Related Q&A

Compound Q&A

How is Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6) typically synthesized?

Methyl 5-bromo-2-fluorobenzoate can be synthesized through the bromination of 2-fluorobenzoic acid w...

Compound Q&A

What industries use Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6)?

Methyl 5-bromo-2-fluorobenzoate is primarily used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling Methyl 5-bromo-2-fluorobenzoate (CAS: 57381-59-6)?

When handling Methyl 5-bromo-2-fluorobenzoate, wear appropriate personal protective equipment (PPE) ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...