Compound Q&A

What precautions should be taken when handling 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1)?

Answer

4-(4-Ethyl-1-piperazinyl)benzoic acid
When handling 4-(4-Ethyl-1-piperazinyl)benzoic acid, it is important to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. This compound should be used in a well-ventilated area or a fume hood. In case of a spill, it is crucial to clean it up using appropriate absorbents and to follow the Material Safety Data Sheet (MSDS) guidelines for disposal.

About

English Name 4-(4-Ethyl-1-piperazinyl)benzoic acid
Molecular Formula C13H18N2O2
Molecular Weight 234.3 g/mol
SMILES CCN1CCN(CC1)C2=CC=C(C=C2)C(=O)O
InChIKey UJKUGZAMAKCYKG-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1)?

4-(4-Ethyl-1-piperazinyl)benzoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1) typically synthesized?

4-(4-Ethyl-1-piperazinyl)benzoic acid is typically synthesized by the coupling of 4-aminobenzoic aci...

Compound Q&A

What industries use 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1)?

4-(4-Ethyl-1-piperazinyl)benzoic acid is primarily used in the pharmaceutical industry as a precurso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...