Compound Q&A

What precautions should be taken when handling 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1)?

Answer

4-(4-Ethyl-1-piperazinyl)benzoic acid
When handling 4-(4-Ethyl-1-piperazinyl)benzoic acid, it is important to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. This compound should be used in a well-ventilated area or a fume hood. In case of a spill, it is crucial to clean it up using appropriate absorbents and to follow the Material Safety Data Sheet (MSDS) guidelines for disposal.

About

English Name 4-(4-Ethyl-1-piperazinyl)benzoic acid
Molecular Formula C13H18N2O2
Molecular Weight 234.29900000000004 g/mol
SMILES CCN1CCN(CC1)C2=CC=C(C=C2)C(=O)O
InChIKey UJKUGZAMAKCYKG-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1)?

4-(4-Ethyl-1-piperazinyl)benzoic acid is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1) typically synthesized?

4-(4-Ethyl-1-piperazinyl)benzoic acid is typically synthesized by the coupling of 4-aminobenzoic aci...

Compound Q&A

What industries use 4-(4-Ethyl-1-piperazinyl)benzoic acid (CAS: 784130-66-1)?

4-(4-Ethyl-1-piperazinyl)benzoic acid is primarily used in the pharmaceutical industry as a precurso...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...