Compound Q&A

What precautions should be taken when handling 3-(3-Fluorophenyl)-3-oxopropanenitrile (CAS: 21667-61-8)?

Answer

3-(3-Fluorophenyl)-3-oxopropanenitrile
When handling 3-(3-Fluorophenyl)-3-oxopropanenitrile (CAS: 21667-61-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbents, and the area should be thoroughly rinsed. Always refer to the safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

CAS No 21667-61-8
English Name 3-(3-Fluorophenyl)-3-oxopropanenitrile
Molecular Formula C9H6FNO
Molecular Weight 152.17 g/mol
SMILES C1=CC(=CC(=C1)F)C(=O)CC#N
InChIKey UNGFCWRGMBVFAS-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(3-Fluorophenyl)-3-oxopropanenitrile (CAS: 21667-61-8)?

3-(3-Fluorophenyl)-3-oxopropanenitrile is a crystalline compound with a molecular weight of approxim...

Compound Q&A

How is 3-(3-Fluorophenyl)-3-oxopropanenitrile (CAS: 21667-61-8) typically synthesized?

3-(3-Fluorophenyl)-3-oxopropanenitrile is commonly synthesized via nucleophilic substitution reactio...

Compound Q&A

What industries use 3-(3-Fluorophenyl)-3-oxopropanenitrile (CAS: 21667-61-8)?

3-(3-Fluorophenyl)-3-oxopropanenitrile is used in various industries, particularly in pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...