Compound Q&A

How is Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8) typically synthesized?

Answer

Methyl (3,4-dihydroxyphenyl)acetate
Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8) can be synthesized via the esterification of methyl acetate with 3,4-dihydroxybenzoic acid. The reaction is typically catalyzed by an acid or base catalyst, and the product can be isolated by recrystallization. The yield of the reaction is generally between 75-90%, with good selectivity towards the desired product.

About

CAS No 25379-88-8
English Name Methyl (3,4-dihydroxyphenyl)acetate
Molecular Formula C9H10O4
Molecular Weight 182.18 g/mol
SMILES COC(=O)CC1=CC(=C(C=C1)O)O
InChIKey UGFILLIGHGZLHE-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8)?

Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8) is a solid compound with a crystalline form. I...

Compound Q&A

What industries use Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8)?

Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8) is used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8)?

When handling Methyl (3,4-dihydroxyphenyl)acetate (CAS: 25379-88-8), it is crucial to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...