Compound Q&A

What precautions should be taken when handling Pyraflufen-ethyl (CAS: 129630-19-9)?

Answer

Pyraflufen-ethyl
When handling Pyraflufen-ethyl, protective equipment such as gloves, safety glasses, and a respirator should be worn. It should be stored in a cool, dry place away from direct sunlight. In case of spill, ensure proper ventilation and use appropriate containment to prevent environmental release. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety guidelines.

About

English Name Pyraflufen-ethyl
Molecular Formula C15H13Cl2F3N2O4
Molecular Weight 413.2 g/mol
SMILES CCOC(=O)COC1=C(C=C(C(=C1)C2=NN(C(=C2Cl)OC(F)F)C)F)Cl
InChIKey APTZNLHMIGJTEW-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pyraflufen-ethyl (CAS: 129630-19-9)?

Pyraflufen-ethyl is a crystalline compound with a molecular weight of approximately 257.26 g/mol. It...

Compound Q&A

How is Pyraflufen-ethyl (CAS: 129630-19-9) typically synthesized?

Pyraflufen-ethyl is typically synthesized via a multi-step process involving the condensation of 5-c...

Compound Q&A

What industries use Pyraflufen-ethyl (CAS: 129630-19-9)?

Pyraflufen-ethyl is primarily used in the agricultural industry as a herbicide. It is also studied f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...