Compound Q&A

What are the physical and chemical properties of Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9)?

Answer

Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate
Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9) is a crystalline solid with a molecular weight of approximately 233.59 g/mol. It is poorly soluble in water but soluble in organic solvents such as methanol and acetonitrile. Chemically, it is reactive and can undergo substitution reactions and condensation reactions. This compound has a melting point of around 150°C and is stable under normal laboratory conditions.

About

English Name Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate
Molecular Formula C9H7ClN2O2
Molecular Weight 210.62 g/mol
SMILES COC(=O)C1=CC2=C(N1)C=CN=C2Cl
InChIKey NFEOJQQNFBVATP-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9) typically synthesized?

Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9) is typically synthesized ...

Compound Q&A

What industries use Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9)?

Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9) is primarily used in the ...

Compound Q&A

What precautions should be taken when handling Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9)?

When handling Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (CAS: 688357-19-9), proper per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...