Compound Q&A

What are the physical and chemical properties of Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1)?

Answer

Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate
Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1) is a crystalline compound with a molecular weight of approximately 319.4 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. This compound is stable under normal temperature and pressure conditions, but it can react with strong bases and acids. It is moderately reactive towards nucleophiles.

About

CAS No 23964-58-1
English Name Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate
Molecular Formula C13H20N2O3S
Molecular Weight 284.38 g/mol
SMILES CCCNC(C)C(=O)NC1=C(SC=C1C)C(=O)OC
InChIKey QTGIAADRBBLJGA-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1) typically synthesized?

Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1) is synthesized vi...

Compound Q&A

What industries use Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1)?

Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1) is used in the ph...

Compound Q&A

What precautions should be taken when handling Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1)?

When handling Methyl 4-methyl-3-[(N-propylalanyl)amino]-2-thiophenecarboxylate (CAS: 23964-58-1), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...