Compound Q&A

What industries use Kobusin (CAS: 36150-23-9)?

Answer

Kobusin
Kobusin finds applications in multiple industries. It is widely used in the pharmaceutical industry for the synthesis of certain drugs. In the polymer industry, it serves as a monomer for the production of advanced materials. Additionally, Kobusin is employed in the development of sensors and semiconductors due to its unique electronic and structural properties.

About

CAS No 36150-23-9
English Name Kobusin
Molecular Formula C21H22O6
Molecular Weight 370.4 g/mol
SMILES COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4=CC5=C(C=C4)OCO5)OC
InChIKey AWOGQCSIVCQXBT-VUEDXXQZSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Kobusin (CAS: 36150-23-9)?

Kobusin is a white crystalline solid with a molecular weight of approximately 242.24 g/mol. It is sl...

Compound Q&A

How is Kobusin (CAS: 36150-23-9) typically synthesized?

Kobusin is synthesized via a multistep process involving the conversion of a suitable precursor to t...

Compound Q&A

What precautions should be taken when handling Kobusin (CAS: 36150-23-9)?

When handling Kobusin, it is essential to wear appropriate personal protective equipment (PPE), incl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...