Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5)?

Answer

2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate
The compound 2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5) is a white crystalline solid with a molecular weight of approximately 241.29 g/mol. It has a pKa of around 12.5, indicating basicity. The compound is slightly soluble in water and soluble in organic solvents like methanol and ethanol. It exhibits good stability under normal conditions but can react with strong acids to form salts.

About

English Name 2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate
Molecular Formula C12H21NO3
Molecular Weight 227.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2(CC(O)C2)C1
InChIKey KAVBYCOMZDNOFX-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:23

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5) typically synthesized?

2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5) is typically s...

Compound Q&A

What industries use 2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5)?

2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5) is used primar...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5)?

When handling 2-Methyl-2-propanyl 2-hydroxy-6-azaspiro[3.4]octane-6-carboxylate (CAS: 1239319-91-5),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...