Compound Q&A

What are the physical and chemical properties of 5-Methyl-2,2'-bipyridine (CAS: 56100-20-0)?

Answer

5-Methyl-2,2'-bipyridine
5-Methyl-2,2'-bipyridine (CAS: 56100-20-0) is a crystalline solid with a molecular weight of approximately 248.21 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and acetonitrile. Chemically, it exhibits mild reactivity towards certain metal ions and can be used as a ligand in coordination chemistry. Its stability and redox properties make it useful in various applications.

About

CAS No 56100-20-0
English Name 5-Methyl-2,2'-bipyridine
Molecular Formula C11H10N2
Molecular Weight 170.22 g/mol
SMILES CC1=CN=C(C=C1)C2=CC=CC=N2
InChIKey LECLRDWVJRSFSE-UHFFFAOYSA-N
Last Updated: 2025-10-28 23:22

Related Q&A

Compound Q&A

How is 5-Methyl-2,2'-bipyridine (CAS: 56100-20-0) typically synthesized?

5-Methyl-2,2'-bipyridine is commonly synthesized via the amination of 2,2'-bipyridine with methylami...

Compound Q&A

What industries use 5-Methyl-2,2'-bipyridine (CAS: 56100-20-0)?

5-Methyl-2,2'-bipyridine (CAS: 56100-20-0) finds applications in pharmaceuticals, where it can act a...

Compound Q&A

What precautions should be taken when handling 5-Methyl-2,2'-bipyridine (CAS: 56100-20-0)?

When handling 5-Methyl-2,2'-bipyridine (CAS: 56100-20-0), it is important to wear protective gloves,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...