Compound Q&A

What are the physical and chemical properties of 2-[(2-Cyanoethyl){4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)diazenyl]phenyl}amino]ethyl acetate (CAS: 58051-98-2)?

Answer

2-[(2-Cyanoethyl){4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)diazenyl]phenyl}amino]ethyl acetate
This compound is a crystalline solid with a high molecular weight. It has low water solubility but is soluble in organic solvents like acetonitrile. It exhibits limited reactivity and is stable under normal conditions. It may undergo hydrolysis in basic conditions.

About

CAS No 58051-98-2
English Name 2-[(2-Cyanoethyl){4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)diazenyl]phenyl}amino]ethyl acetate
Molecular Formula C20H18N6O4S
Molecular Weight 438.5 g/mol
SMILES CC(=O)OCCN(CCC#N)C1=CC=C(C=C1)N=NC2=NC3=C(S2)C=C(C=C3)[N+](=O)[O-]
InChIKey ZNUBBVSUTSNSIM-WCWDXBQESA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is 2-[(2-Cyanoethyl){4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)diazenyl]phenyl}amino]ethyl acetate (CAS: 58051-98-2) typically synthesized?

This compound is synthesized via a multi-step process involving diazotization and coupling reactions...

Compound Q&A

What industries use 2-[(2-Cyanoethyl){4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)diazenyl]phenyl}amino]ethyl acetate (CAS: 58051-98-2)?

This compound is primarily used in pharmaceuticals for its potential as a drug precursor. It also fi...

Compound Q&A

What precautions should be taken when handling 2-[(2-Cyanoethyl){4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)diazenyl]phenyl}amino]ethyl acetate (CAS: 58051-98-2)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves and sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...