Compound Q&A

How is (3S)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 734529-57-8) typically synthesized?

Answer

(3S)-3-Amino-3-(3-nitrophenyl)propanoic acid
(3S)-3-Amino-3-(3-nitrophenyl)propanoic acid can be synthesized by the condensation of 3-nitrobenzaldehyde with 3-aminopropanoyl chloride in the presence of an acid catalyst such as sulfuric acid. The reaction typically proceeds with good yield and selectivity. The product can be purified by recrystallization from appropriate solvents to achieve high purity.

About

English Name (3S)-3-Amino-3-(3-nitrophenyl)propanoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])C(CC(=O)O)N
InChIKey SJBFILRQMRECCK-QMMMGPOBSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 734529-57-8)?

(3S)-3-Amino-3-(3-nitrophenyl)propanoic acid is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use (3S)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 734529-57-8)?

(3S)-3-Amino-3-(3-nitrophenyl)propanoic acid is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling (3S)-3-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 734529-57-8)?

When handling (3S)-3-Amino-3-(3-nitrophenyl)propanoic acid, it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...