Compound Q&A

What precautions should be taken when handling 5-Amino-2-bromo-4-methylbenzoic acid (CAS: 745048-63-9)?

Answer

5-Amino-2-bromo-4-methylbenzoic acid
When handling 5-Amino-2-bromo-4-methylbenzoic acid, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to prevent inhalation of vapors. In case of a spill, it should be cleaned up using proper spill containment procedures, and the material safety data sheet (MSDS) should be consulted for detailed instructions.

About

English Name 5-Amino-2-bromo-4-methylbenzoic acid
Molecular Formula C8H8BrNO2
Molecular Weight 230.06 g/mol
SMILES CC1=CC(=C(C=C1N)C(=O)O)Br
InChIKey WXEDVFCZCKWBCL-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2-bromo-4-methylbenzoic acid (CAS: 745048-63-9)?

5-Amino-2-bromo-4-methylbenzoic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 5-Amino-2-bromo-4-methylbenzoic acid (CAS: 745048-63-9) typically synthesized?

5-Amino-2-bromo-4-methylbenzoic acid is typically synthesized via a multi-step process involving bro...

Compound Q&A

What industries use 5-Amino-2-bromo-4-methylbenzoic acid (CAS: 745048-63-9)?

5-Amino-2-bromo-4-methylbenzoic acid is primarily used in the pharmaceutical industry for the synthe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...