Compound Q&A

What are the physical and chemical properties of 2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5)?

Answer

2-(3,5-Dimethylphenyl)quinoline
2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5) is a crystalline solid with a molecular weight of approximately 240.26 g/mol. It has a melting point of around 220-222°C and is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable under normal conditions but may react with strong acids and bases. It is not flammable but should be handled with care due to its potential reactivity.

About

English Name 2-(3,5-Dimethylphenyl)quinoline
Molecular Formula C17H15N
Molecular Weight 233.31 g/mol
SMILES CC1=CC(=CC(=C1)C2=NC3=CC=CC=C3C=C2)C
InChIKey LLXSSVSSSWIZIF-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

How is 2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5) typically synthesized?

2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5) is typically synthesized via a quinoline ring fo...

Compound Q&A

What industries use 2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5)?

2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5) is used in various industries, including pharmac...

Compound Q&A

What precautions should be taken when handling 2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5)?

When handling 2-(3,5-Dimethylphenyl)quinoline (CAS: 1056451-44-5), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...