Compound Q&A

How is Methyl (3-amino-2,6-difluorophenyl)acetate (CAS: 361336-80-3) typically synthesized?

Answer

Methyl (3-amino-2,6-difluorophenyl)acetate
Methyl (3-amino-2,6-difluorophenyl)acetate is synthesized via a multi-step process involving the reduction of a precursor diazonium salt followed by the coupling reaction with a methyl ester. Commonly used catalysts include palladium-based complexes. The reaction typically yields a high selectivity towards the desired product with a yield of around 75-85%. Care must be taken to use appropriate safety equipment and handle the intermediate diazonium salt under inert conditions to prevent unwanted reactions.

About

English Name Methyl (3-amino-2,6-difluorophenyl)acetate
Molecular Formula C9H9F2NO2
Molecular Weight 201.17 g/mol
SMILES COC(=O)CC1=C(C=CC(=C1F)N)F
InChIKey ROSSYYRWJGVZJB-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (3-amino-2,6-difluorophenyl)acetate (CAS: 361336-80-3)?

Methyl (3-amino-2,6-difluorophenyl)acetate is a crystalline compound with a molecular weight of appr...

Compound Q&A

What industries use Methyl (3-amino-2,6-difluorophenyl)acetate (CAS: 361336-80-3)?

Methyl (3-amino-2,6-difluorophenyl)acetate finds applications in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Methyl (3-amino-2,6-difluorophenyl)acetate (CAS: 361336-80-3)?

When handling Methyl (3-amino-2,6-difluorophenyl)acetate, it is crucial to wear proper personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...