Compound Q&A

What industries use Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CAS: 72850-79-4)?

Answer

Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate
Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate is used in various industries, particularly in pharmaceuticals and fine chemicals. It serves as a valuable intermediate in the synthesis of complex organic molecules and pharmaceuticals. Additionally, it finds applications in the production of functional polymers and as a reagent in analytical chemistry for the development of new detection methods.

About

CAS No 72850-79-4
English Name Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate
Molecular Formula C7H5BrF3NO2S
Molecular Weight 304.09 g/mol
SMILES CCOC(=O)C1=C(N=C(S1)Br)C(F)(F)F
InChIKey XPAISTXWPBHIMZ-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CAS: 72850-79-4)?

Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate is a white to off-white crystalline sol...

Compound Q&A

How is Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CAS: 72850-79-4) typically synthesized?

Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate can be synthesized via a multi-step pro...

Compound Q&A

What precautions should be taken when handling Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate (CAS: 72850-79-4)?

When handling Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate, it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...