Compound Q&A

How is 1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 54240-36-7) typically synthesized?

Answer

1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (1:1)
This compound is synthesized through a multi-step process involving alkylation of a trichloromethyl benzene derivative, followed by amino substitution and hydrochloric acid derivatization. Common catalysts include palladium-based catalysts, and the overall yield is typically around 70-80%. The reaction conditions include controlled temperature and pressure to ensure high selectivity and yield.

About

CAS No 54240-36-7
English Name 1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (1:1)
Molecular Formula C13H19Cl2F3N2O
Molecular Weight 347.21 g/mol
SMILES CC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O.Cl
InChIKey MMCDXJOMPMIKGP-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 54240-36-7)?

This compound is a colorless crystalline solid with a molecular weight of approximately 519.75 g/mol...

Compound Q&A

What industries use 1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 54240-36-7)?

This compound is primarily used in the pharmaceutical industry as an intermediate for the synthesis ...

Compound Q&A

What precautions should be taken when handling 1-[4-Amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 54240-36-7)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...