Compound Q&A

How is 2,2'-Oxydianiline (CAS: 24878-25-9) typically synthesized?

Answer

2,2'-Oxydianiline
2,2'-Oxydianiline is synthesized by the condensation of aniline with itself in the presence of a catalyst such as sulfuric acid. The reaction involves the formation of an intermediate that undergoes ring closure to form the 2,2'-oxydianiline product. The yield is typically around 90%, and the reaction is carried out under mild conditions to ensure high selectivity.

About

CAS No 24878-25-9
English Name 2,2'-Oxydianiline
Molecular Formula C12H12N2O
Molecular Weight 200.24 g/mol
SMILES C1=CC=C(C(=C1)N)OC2=CC=CC=C2N
InChIKey GOJFAKBEASOYNM-UHFFFAOYSA-N
Last Updated: 2025-10-28 15:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Oxydianiline (CAS: 24878-25-9)?

2,2'-Oxydianiline is a white crystalline solid with a molecular weight of approximately 132.15 g/mol...

Compound Q&A

What industries use 2,2'-Oxydianiline (CAS: 24878-25-9)?

2,2'-Oxydianiline is used in the pharmaceutical industry for the synthesis of certain drugs, in the ...

Compound Q&A

What precautions should be taken when handling 2,2'-Oxydianiline (CAS: 24878-25-9)?

When handling 2,2'-Oxydianiline, it is important to wear appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...