Compound Q&A

How is Methyl [4-(benzyloxy)phenyl]acetate (CAS: 68641-16-7) typically synthesized?

Answer

Methyl [4-(benzyloxy)phenyl]acetate
Methyl [4-(benzyloxy)phenyl]acetate is usually synthesized via a Fischer esterification reaction between 4-benzyloxyphenol and acetic acid in the presence of a strong acid catalyst, such as sulfuric acid. The reaction is typically carried out in an organic solvent at room temperature. The yield is usually high, with good selectivity towards the desired ester product.

About

CAS No 68641-16-7
English Name Methyl [4-(benzyloxy)phenyl]acetate
Molecular Formula C16H16O3
Molecular Weight 256.3 g/mol
SMILES COC(=O)CC1=CC=C(C=C1)OCC2=CC=CC=C2
InChIKey OUWFDISHMBDYON-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl [4-(benzyloxy)phenyl]acetate (CAS: 68641-16-7)?

Methyl [4-(benzyloxy)phenyl]acetate is a colorless to light yellow liquid with a molecular weight of...

Compound Q&A

What industries use Methyl [4-(benzyloxy)phenyl]acetate (CAS: 68641-16-7)?

Methyl [4-(benzyloxy)phenyl]acetate is primarily used in the fragrance and flavor industry due to it...

Compound Q&A

What precautions should be taken when handling Methyl [4-(benzyloxy)phenyl]acetate (CAS: 68641-16-7)?

When handling Methyl [4-(benzyloxy)phenyl]acetate (CAS: 68641-16-7), it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...