Compound Q&A

How is 1,2-Dichloro-4-methyl-5-nitrobenzene (CAS: 7494-45-3) typically synthesized?

Answer

1,2-Dichloro-4-methyl-5-nitrobenzene
1,2-Dichloro-4-methyl-5-nitrobenzene can be synthesized via the nitration of 4-methyl-1,2-dichlorobenzene followed by appropriate purification steps. Common catalysts include sulfuric acid, and the reaction typically yields a product with good selectivity and moderate yield.

About

CAS No 7494-45-3
English Name 1,2-Dichloro-4-methyl-5-nitrobenzene
Molecular Formula C7H5Cl2NO2
Molecular Weight 206.03 g/mol
SMILES CC1=CC(=C(C=C1[N+](=O)[O-])Cl)Cl
InChIKey AOTWCYSQDSKAQT-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Dichloro-4-methyl-5-nitrobenzene (CAS: 7494-45-3)?

1,2-Dichloro-4-methyl-5-nitrobenzene (CAS: 7494-45-3) is a solid with a crystalline form. Its molecu...

Compound Q&A

What industries use 1,2-Dichloro-4-methyl-5-nitrobenzene (CAS: 7494-45-3)?

1,2-Dichloro-4-methyl-5-nitrobenzene (CAS: 7494-45-3) is used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 1,2-Dichloro-4-methyl-5-nitrobenzene (CAS: 7494-45-3)?

When handling 1,2-Dichloro-4-methyl-5-nitrobenzene (CAS: 7494-45-3), appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...