Compound Q&A

What precautions should be taken when handling (2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159610-82-9)?

Answer

(2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid
When handling (2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159610-82-9), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. The compound should be handled in a well-ventilated area or a fume hood to avoid inhalation. In case of a spill, use appropriate absorbent materials like calcium carbonate or sodium bicarbonate. The Material Safety Data Sheet (MSDS) should be consulted for detailed emergency procedures and safety information.

About

English Name (2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid
Molecular Formula C26H23NO4
Molecular Weight 413.47 g/mol
SMILES C1=CC=C(C=C1)C=CCC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
InChIKey ZFMHHKMOLFNMMV-DDVUFSRBSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159610-82-9)?

The compound (2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159...

Compound Q&A

How is (2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159610-82-9) typically synthesized?

(2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159610-82-9) can...

Compound Q&A

What industries use (2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159610-82-9)?

(2S,4E)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-phenyl-4-pentenoic acid (CAS: 159610-82-9) is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...