Compound Q&A

How is (10-Bromo-9-anthryl)boronic acid (CAS: 641144-16-3) typically synthesized?

Answer

(10-Bromo-9-anthryl)boronic acid
(10-Bromo-9-anthryl)boronic acid can be synthesized by bromination of 9-anthrylboronic acid followed by purification. The synthesis typically involves the use of bromine in an organic solvent. The yield is moderate, and the reaction is selective towards the bromination of the anthryl group. Catalysts like tributylphosphine can be used to improve the reaction efficiency.

About

English Name (10-Bromo-9-anthryl)boronic acid
Molecular Formula C14H10BBrO2
Molecular Weight 300.95 g/mol
SMILES B(C1=C2C=CC=CC2=C(C3=CC=CC=C13)Br)(O)O
InChIKey FAVOIVPFJSKYBE-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of (10-Bromo-9-anthryl)boronic acid (CAS: 641144-16-3)?

(10-Bromo-9-anthryl)boronic acid is a crystalline solid with a molecular weight of approximately 414...

Compound Q&A

What industries use (10-Bromo-9-anthryl)boronic acid (CAS: 641144-16-3)?

(10-Bromo-9-anthryl)boronic acid is widely used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling (10-Bromo-9-anthryl)boronic acid (CAS: 641144-16-3)?

When handling (10-Bromo-9-anthryl)boronic acid, it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...