Compound Q&A

What are the physical and chemical properties of 1,2-Bis(trifluoromethyl)benzene (CAS: 433-95-4)?

Answer

1,2-Bis(trifluoromethyl)benzene
1,2-Bis(trifluoromethyl)benzene (CAS: 433-95-4) is a colorless, crystalline solid with a high melting point of 86.5°C. The molecular weight is 217.09 g/mol. It has limited water solubility and is highly soluble in organic solvents such as benzene, toluene, and chloroform. This compound is chemically stable under normal conditions but reacts with strong reducing agents. It is used in the synthesis of various pharmaceuticals and materials due to its unique trifluoromethyl substituents.

About

CAS No 433-95-4
English Name 1,2-Bis(trifluoromethyl)benzene
Molecular Formula C8H4F6
Molecular Weight 214.11 g/mol
SMILES C1=CC=C(C(=C1)C(F)(F)F)C(F)(F)F
InChIKey XXZOEDQFGXTEAD-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

How is 1,2-Bis(trifluoromethyl)benzene (CAS: 433-95-4) typically synthesized?

1,2-Bis(trifluoromethyl)benzene is synthesized via the Friedel-Crafts alkylation of benzene with tri...

Compound Q&A

What industries use 1,2-Bis(trifluoromethyl)benzene (CAS: 433-95-4)?

1,2-Bis(trifluoromethyl)benzene (CAS: 433-95-4) is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 1,2-Bis(trifluoromethyl)benzene (CAS: 433-95-4)?

When handling 1,2-Bis(trifluoromethyl)benzene (CAS: 433-95-4), appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...