Compound Q&A

What industries use methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0)?

Answer

methyl 4-amino-2-methoxy-5-nitrobenzoate
Methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0) is predominantly used in the pharmaceutical industry for the synthesis of certain medicinals. It also finds applications in the polymer industry for the development of new materials with specific properties. Additionally, it can be used in the sensor industry for detecting specific analytes due to its reactive functional groups.

About

CAS No 59338-84-0
English Name methyl 4-amino-2-methoxy-5-nitrobenzoate
Molecular Formula C9H10N2O5
Molecular Weight 226.19 g/mol
SMILES COC1=CC(=C(C=C1C(=O)OC)[N+](=O)[O-])N
InChIKey CUJURECWKNETII-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0)?

Methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0) is a white crystalline solid with a molec...

Compound Q&A

How is methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0) typically synthesized?

Methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0) is commonly synthesized by coupling metho...

Compound Q&A

What precautions should be taken when handling methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0)?

When handling methyl 4-amino-2-methoxy-5-nitrobenzoate (CAS: 59338-84-0), it is important to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...