Compound Q&A

What industries use 2,2'-Methylenebis(6-bromo-4-chlorophenol) (CAS: 15435-29-7)?

Answer

2,2'-Methylenebis(6-bromo-4-chlorophenol)
2,2'-Methylenebis(6-bromo-4-chlorophenol) is used in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of drugs. It is also utilized in the polymer industry as a stabilizer, and in the manufacturing of sensors and semiconductors due to its unique optical and thermal properties.

About

CAS No 15435-29-7
English Name 2,2'-Methylenebis(6-bromo-4-chlorophenol)
Molecular Formula C13H8Br2Cl2O2
Molecular Weight 426.92 g/mol
SMILES Clc1cc(Cc2cc(Cl)cc(c2O)Br)c(c(c1)Br)O
InChIKey TYBHZVUFOINFDV-UHFFFAOYSA-N
Last Updated: 2025-10-28 10:54

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Methylenebis(6-bromo-4-chlorophenol) (CAS: 15435-29-7)?

2,2'-Methylenebis(6-bromo-4-chlorophenol) is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 2,2'-Methylenebis(6-bromo-4-chlorophenol) (CAS: 15435-29-7) typically synthesized?

2,2'-Methylenebis(6-bromo-4-chlorophenol) is synthesized via the condensation reaction of 6-bromo-4-...

Compound Q&A

What precautions should be taken when handling 2,2'-Methylenebis(6-bromo-4-chlorophenol) (CAS: 15435-29-7)?

When handling 2,2'-Methylenebis(6-bromo-4-chlorophenol), appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...