Compound Q&A

How should 4-Aminobenzenesulfonyl chloride (CAS: 24939-24-0) be stored?

Answer

4-Aminobenzenesulfonyl chloride
4-Aminobenzenesulfonyl chloride should be stored in a cool, dry, and well-ventilated area. It should be kept away from direct sunlight and heat sources to prevent decomposition. The compound should be stored in a tightly sealed container to protect it from moisture and other environmental factors. It is advisable to store it in a secure location to prevent accidental exposure and to comply with local regulations and safety guidelines.

About

CAS No 24939-24-0
English Name 4-Aminobenzenesulfonyl chloride
Molecular Formula C6H6ClNO2S
Molecular Weight 191.64 g/mol
SMILES C1=CC(=CC=C1N)S(=O)(=O)Cl
InChIKey MTOJDBAZGOYUOZ-UHFFFAOYSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is 4-Aminobenzenesulfonyl chloride (CAS: 24939-24-0)?

4-Aminobenzenesulfonyl chloride is a chemical compound with the CAS number 24939-24-0. It is an orga...

Compound Q&A

What are the main uses of 4-Aminobenzenesulfonyl chloride (CAS: 24939-24-0)?

4-Aminobenzenesulfonyl chloride is primarily used as an intermediate in the synthesis of various org...

Compound Q&A

Is 4-Aminobenzenesulfonyl chloride (CAS: 24939-24-0) safe?

4-Aminobenzenesulfonyl chloride, like many chemical compounds, requires appropriate safety precautio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...