Compound Q&A

What is 3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2)?

Answer

3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid
3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2) is an organic compound with a molecular structure that includes a trifluoromethyl group and a 1,2,4-oxadiazole ring fused to a benzene ring. It is characterized by its high reactivity and stability. This compound is used in various applications, including pharmaceuticals, as a synthesis intermediate, and in research for its unique chemical properties.

About

English Name 3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid
Molecular Formula C10H5F3N2O3
Molecular Weight 258.16 g/mol
SMILES C1=CC(=CC(=C1)C(=O)O)C2=NOC(=N2)C(F)(F)F
InChIKey ZTOAUVQUTVRHBJ-UHFFFAOYSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What are the main uses of 3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2)?

3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2) is primarily used as a ...

Compound Q&A

Is 3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2) safe?

3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2) is generally safe under...

Compound Q&A

How should 3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2) be stored?

3-[5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS: 1092400-82-2) should be stored in a d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...