Compound Q&A

Is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(4-methylphenyl)(diphenyl)methyl]amino}butanoic acid (CAS: 851392-68-2) safe?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(4-methylphenyl)(diphenyl)methyl]amino}butanoic acid
The safety of this compound depends on the context of use. It is generally safe when handled with appropriate precautions, such as wearing gloves and protective eyewear. However, it should be stored away from heat and direct sunlight to minimize the risk of degradation.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(4-methylphenyl)(diphenyl)methyl]amino}butanoic acid
Molecular Formula C39H36N2O4
Molecular Weight 596.73 g/mol
SMILES Cc1ccc(cc1)C(c1ccccc1)(c1ccccc1)NCC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2c2c1cccc2
InChIKey RXKBBKLPMHPIKD-BHVANESWSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(4-methylphenyl)(diphenyl)methyl]amino}butanoic acid (CAS: 851392-68-2)?

This compound is a complex organic acid with a fluorenecarbonyl and a phenyl-diphenylmethyl side cha...

Compound Q&A

What are the main uses of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(4-methylphenyl)(diphenyl)methyl]amino}butanoic acid (CAS: 851392-68-2)?

This compound is primarily used as an intermediate in the synthesis of pharmaceuticals and as a rese...

Compound Q&A

How should (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-{[(4-methylphenyl)(diphenyl)methyl]amino}butanoic acid (CAS: 851392-68-2) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...