Compound Q&A

What are the main uses of 3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7)?

Answer

3-(Trifluoromethyl)pyrazine-2-carboxylic acid
3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7) is primarily used in research as a precursor for the synthesis of other organic compounds. It also finds applications in the pharmaceutical industry for its potential use in developing new drugs, particularly in the fields of antimicrobial and antiviral research. Additionally, it is utilized in the formulation of certain food additives due to its aromatic and bitter taste characteristics.

About

English Name 3-(Trifluoromethyl)pyrazine-2-carboxylic acid
Molecular Formula C6H3F3N2O2
Molecular Weight 192.1 g/mol
SMILES C1=CN=C(C(=N1)C(=O)O)C(F)(F)F
InChIKey ZHOIMHWVXJSOBX-UHFFFAOYSA-N
Last Updated: 2025-10-28 07:38

Related Q&A

Compound Q&A

What is 3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7)?

3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7) is an organic compound with the mol...

Compound Q&A

Is 3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7) safe?

3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7) may pose some safety hazards due to...

Compound Q&A

How should 3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7) be stored?

3-(Trifluoromethyl)pyrazine-2-carboxylic acid (CAS: 870787-06-7) should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...