Compound Q&A

What is 4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate (CAS: 86061-01-0)?

Answer

4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate
4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate is a complex organic compound with a unique structure, featuring a pentafluorophenyl group, a fluorene derivative, and an aspartate moiety. This compound is primarily used in medicinal chemistry and drug development due to its specific functional groups and potential for drug-like properties.

About

CAS No 86061-01-0
English Name 4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate
Molecular Formula C29H24F5NO6
Molecular Weight 577.5 g/mol
SMILES O=C(OC1=C(F)C(F)=C(F)C(F)=C1F)[C@@H](NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)CC(OC(C)(C)C)=O
InChIKey DWYWJUBBXKYAMY-IBGZPJMESA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What are the main uses of 4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate (CAS: 86061-01-0)?

The main uses of this compound include its application in medicinal chemistry as a precursor or inte...

Compound Q&A

Is 4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate (CAS: 86061-01-0) safe?

While 4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate...

Compound Q&A

How should 4-(2-Methyl-2-propanyl) 1-(pentafluorophenyl) N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-aspartate (CAS: 86061-01-0) be stored?

This compound should be stored in a cool, dry place, away from direct sunlight and heat sources. It ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...