Compound Q&A

How should 4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9) be stored?

Answer

4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide
4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9) should be stored in a cool, dry place away from direct sunlight and sources of heat. It is recommended to keep the compound in a tightly sealed container to prevent degradation. Storage at a temperature not exceeding 25°C is ideal to maintain its stability and efficacy.

About

English Name 4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide
Molecular Formula C15H17N3O2S
Molecular Weight 303.39 g/mol
SMILES Cc1ccc(cc1)C(=NNc1ccc(cc1)S(=O)(=O)N)C
InChIKey JCRSPJLUSHTDDS-UHFFFAOYSA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What is 4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9)?

4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9) is a complex or...

Compound Q&A

What are the main uses of 4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9)?

4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9) is primarily us...

Compound Q&A

Is 4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9) safe?

4-[2-[1-(4-Methylphenyl)ethylidene]hydrazinyl]benzenesulfonamide (CAS: 1061214-06-9) is generally co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...