Compound Q&A

What are the main uses of 3-Bromo-4-chloroquinoline (CAS: 74575-17-0)?

Answer

3-Bromo-4-chloroquinoline
3-Bromo-4-chloroquinoline is primarily used in pharmaceutical research for the synthesis of other quinoline derivatives, which have potential medicinal properties. It is also used in the development of fluorescent dyes and as a precursor in various organic synthesis reactions.

About

CAS No 74575-17-0
English Name 3-Bromo-4-chloroquinoline
Molecular Formula C9H5BrClN
Molecular Weight 242.5 g/mol
SMILES C1=CC=C2C(=C1)C(=C(C=N2)Br)Cl
InChIKey WRRLTIGYGHAAOP-UHFFFAOYSA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What is 3-Bromo-4-chloroquinoline (CAS: 74575-17-0)?

3-Bromo-4-chloroquinoline is a synthetic organic compound with the CAS number 74575-17-0. It is a ye...

Compound Q&A

Is 3-Bromo-4-chloroquinoline (CAS: 74575-17-0) safe?

3-Bromo-4-chloroquinoline is generally considered safe when handled with appropriate safety precauti...

Compound Q&A

How should 3-Bromo-4-chloroquinoline (CAS: 74575-17-0) be stored?

3-Bromo-4-chloroquinoline should be stored in a cool, dry place away from direct sunlight and heat s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...