Compound Q&A

What is 2,3-Dihydro-1-benzofuran-6-ylboronic acid (CAS: 763120-44-1)?

Answer

2,3-Dihydro-1-benzofuran-6-ylboronic acid
2,3-Dihydro-1-benzofuran-6-ylboronic acid is an organic compound with the CAS number 763120-44-1. It is a derivative of benzofuran with a boronic acid group. The chemical formula is C10H8B03. This compound is used in various research applications and is a key intermediate in organic synthesis.

About

English Name 2,3-Dihydro-1-benzofuran-6-ylboronic acid
Molecular Formula C8H9BO3
Molecular Weight 163.97 g/mol
SMILES B(C1=CC2=C(CCO2)C=C1)(O)O
InChIKey OQULHKYTKYFWIV-UHFFFAOYSA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What are the main uses of 2,3-Dihydro-1-benzofuran-6-ylboronic acid (CAS: 763120-44-1)?

2,3-Dihydro-1-benzofuran-6-ylboronic acid is primarily used as a reagent in organic synthesis, parti...

Compound Q&A

Is 2,3-Dihydro-1-benzofuran-6-ylboronic acid (CAS: 763120-44-1) safe?

2,3-Dihydro-1-benzofuran-6-ylboronic acid is generally safe when handled properly. However, it is im...

Compound Q&A

How should 2,3-Dihydro-1-benzofuran-6-ylboronic acid (CAS: 763120-44-1) be stored?

2,3-Dihydro-1-benzofuran-6-ylboronic acid should be stored in a cool, dry place, protected from ligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...