Compound Q&A

What is Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- (CAS: 131968-74-6)?

Answer

Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel-
Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- is a chemical compound with the CAS number 131968-74-6. It is a white or light yellow crystalline powder with a molecular formula of C12H15NO2 and a molecular weight of approximately 201.26. This compound is known for its acidic and hydroxy functionalities, which contribute to its reactivity in various chemical reactions.

About

English Name Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel-
Molecular Formula C10H13NO3
Molecular Weight 195.21 g/mol
SMILES COC(=O)C(C(C1=CC=CC=C1)N)O
InChIKey WZPZWAQKLOPJEL-DTWKUNHWSA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What are the main uses of Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- (CAS: 131968-74-6)?

Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- is primarily used in pharmaceu...

Compound Q&A

Is Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- (CAS: 131968-74-6) safe?

Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- is generally considered safe u...

Compound Q&A

How should Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- (CAS: 131968-74-6) be stored?

Benzenepropanoic acid, β-amino-α-hydroxy-, methyl ester, (αR,βS)-rel- should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...