Compound Q&A

What is Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7)?

Answer

Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate
Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7) is a chemical compound with the molecular formula C14H20BrN2O3. It is a piperazine derivative containing a tert-butyl group, a bromoethyl group, and a carboxylate group. This compound is used primarily in the pharmaceutical and research industries for its potential as a precursor or intermediate in the synthesis of other compounds.

About

English Name Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate
Molecular Formula C11H21BrN2O2
Molecular Weight 293.21 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)CCBr
InChIKey IWSFZKCIZFXAFT-UHFFFAOYSA-N
Last Updated: 2025-10-27 23:53

Related Q&A

Compound Q&A

What are the main uses of Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7)?

Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7) is mainly used as an intermed...

Compound Q&A

Is Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7) safe?

Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7) is generally safe when handle...

Compound Q&A

How should Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7) be stored?

Tert-butyl 4-(2-bromoethyl)piperazine-1-carboxylate (CAS: 655225-01-7) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...