Compound Q&A

What are the main uses of Azido-PEG4-t-butyl ester (CAS: 581066-04-8)?

Answer

Azido-PEG4-t-butyl ester
Azido-PEG4-t-butyl ester is primarily used in bioconjugation and drug delivery applications. It serves as a versatile linker for attaching azido groups to various biomolecules, enabling their conjugation with other molecules. It also finds applications in polymer chemistry and materials science.

About

English Name Azido-PEG4-t-butyl ester
Molecular Formula C15H29N3O6
Molecular Weight 347.41 g/mol
SMILES CC(C)(C)OC(=O)CCOCCOCCOCCOCCN=[N+]=[N-]
InChIKey KUOGRGKKXWMJFM-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is Azido-PEG4-t-butyl ester (CAS: 581066-04-8)?

Azido-PEG4-t-butyl ester (CAS: 581066-04-8) is a chemical compound used as a linker for the introduc...

Compound Q&A

Is Azido-PEG4-t-butyl ester (CAS: 581066-04-8) safe?

Azido-PEG4-t-butyl ester (CAS: 581066-04-8) is generally safe when handled with appropriate precauti...

Compound Q&A

How should Azido-PEG4-t-butyl ester (CAS: 581066-04-8) be stored?

Azido-PEG4-t-butyl ester should be stored in a cool, dry place, away from direct sunlight and heat s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...