Compound Q&A

How should 2-Methyl-2-proanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate (CAS: 1034975-35-3) be stored?

Answer

2-Methyl-2-propanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate
2-Methyl-2-proanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate should be stored in a cool, dry place away from direct sunlight and moisture. It is best kept in a tightly sealed container to prevent degradation. Store it at a temperature below 25°C and avoid exposing it to high temperatures or excessive humidity to maintain its stability and integrity.

About

English Name 2-Methyl-2-propanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate
Molecular Formula C16H25N3O2
Molecular Weight 291.4 g/mol
SMILES CN1CCN(CC1)c1ccc(c(c1)N)C(=O)OC(C)(C)C
InChIKey DIFVPEGUJIXKOC-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate (CAS: 1034975-35-3)?

2-Methyl-2-propanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate is a chemical compound with a CAS num...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate (CAS: 1034975-35-3)?

2-Methyl-2-propanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate is primarily used in pharmaceutical r...

Compound Q&A

Is 2-Methyl-2-proanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate (CAS: 1034975-35-3) safe?

2-Methyl-2-proanyl 2-amino-4-(4-methyl-1-piperazinyl)benzoate is generally considered safe when hand...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...