Compound Q&A

Is (2-Chloro-3-methoxyphenyl)boronic acid (CAS: 854778-30-6) safe?

Answer

(2-Chloro-3-methoxyphenyl)boronic acid
(2-Chloro-3-methoxyphenyl)boronic acid is generally considered safe when handled with appropriate precautions. However, it should be used in a fume hood to minimize inhalation risks. Contact with skin or eyes should be avoided, and proper protective equipment, such as gloves and goggles, should be worn. Ensure good ventilation during use.

About

English Name (2-Chloro-3-methoxyphenyl)boronic acid
Molecular Formula C7H8BClO3
Molecular Weight 186.4 g/mol
SMILES B(C1=C(C(=CC=C1)OC)Cl)(O)O
InChIKey ZDWONVAXOXYOJK-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is (2-Chloro-3-methoxyphenyl)boronic acid (CAS: 854778-30-6)?

(2-Chloro-3-methoxyphenyl)boronic acid is an organic compound with the molecular formula C9H9ClO3B. ...

Compound Q&A

What are the main uses of (2-Chloro-3-methoxyphenyl)boronic acid (CAS: 854778-30-6)?

(2-Chloro-3-methoxyphenyl)boronic acid is primarily used in organic synthesis as a boronic acid prec...

Compound Q&A

How should (2-Chloro-3-methoxyphenyl)boronic acid (CAS: 854778-30-6) be stored?

(2-Chloro-3-methoxyphenyl)boronic acid should be stored in a cool, dry place, away from direct sunli...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...