Compound Q&A

What are the main uses of (1R,5S,6R)-3-(tert-butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (CAS: 927679-54-7)?

Answer

(1R,5S,6R)-3-(tert-butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid
This compound is primarily used as a synthetic intermediate in the pharmaceutical industry, particularly for the production of drugs and other chemical compounds. It also finds applications in research and development for new chemical entities.

About

English Name (1R,5S,6R)-3-(tert-butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid
Molecular Formula C11H17NO4
Molecular Weight 227.26 g/mol
SMILES CC(C)(C)OC(=O)N1CC2C(C1)C2C(=O)O
InChIKey GYEQQDCMLKKYGG-JIGDXULJSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is (1R,5S,6R)-3-(tert-butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (CAS: 927679-54-7)?

It is a cyclic amide with a unique azabicyclic structure, commonly used as an intermediate in organi...

Compound Q&A

Is (1R,5S,6R)-3-(tert-butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (CAS: 927679-54-7) safe?

The compound is generally considered safe under proper handling and storage conditions. It is import...

Compound Q&A

How should (1R,5S,6R)-3-(tert-butoxycarbonyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (CAS: 927679-54-7) be stored?

This compound should be stored under conditions that prevent exposure to moisture and light. It shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...