Compound Q&A

What are the main uses of 3,4',5-Biphenyltricarboxylic acid (CAS: 677010-20-7)?

Answer

3,4',5-Biphenyltricarboxylic acid
3,4',5-Biphenyltricarboxylic acid is primarily used in the pharmaceutical industry as a starting material for the synthesis of drugs. It is also used in the dye industry for the production of various dyes and pigments. Additionally, it serves as a reagent in organic chemistry for the preparation of other compounds.

About

English Name 3,4',5-Biphenyltricarboxylic acid
Molecular Formula C15H10O6
Molecular Weight 286.24 g/mol
SMILES c1cc(ccc1c2cc(cc(c2)C(=O)O)C(=O)O)C(=O)O
InChIKey LQEZHWGJSWHXPJ-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is 3,4',5-Biphenyltricarboxylic acid (CAS: 677010-20-7)?

3,4',5-Biphenyltricarboxylic acid is a colorless crystalline compound with the chemical formula C14H...

Compound Q&A

Is 3,4',5-Biphenyltricarboxylic acid (CAS: 677010-20-7) safe?

3,4',5-Biphenyltricarboxylic acid is generally considered safe when handled properly. However, it is...

Compound Q&A

How should 3,4',5-Biphenyltricarboxylic acid (CAS: 677010-20-7) be stored?

3,4',5-Biphenyltricarboxylic acid should be stored in a cool, dry place, away from heat and light to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...