Compound Q&A

What are the main uses of 5-Quinoxalinesulfonyl chloride (CAS: 844646-88-4)?

Answer

5-Quinoxalinesulfonyl chloride
5-Quinoxalinesulfonyl chloride is primarily used in the synthesis of pharmaceuticals, dyes, and other organic compounds. It serves as a key intermediate in the preparation of various functionalized compounds, making it valuable in both academic and industrial research settings.

About

English Name 5-Quinoxalinesulfonyl chloride
Molecular Formula C8H5ClN2O2S
Molecular Weight 228.66 g/mol
SMILES ClS(=O)(=O)c1cccc2c1nccn2
InChIKey NAKORIYAIZIQHQ-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is 5-Quinoxalinesulfonyl chloride (CAS: 844646-88-4)?

5-Quinoxalinesulfonyl chloride is an organic compound with the CAS number 844646-88-4. It is a white...

Compound Q&A

Is 5-Quinoxalinesulfonyl chloride (CAS: 844646-88-4) safe?

5-Quinoxalinesulfonyl chloride can be hazardous due to its reactivity and corrosive nature. It is im...

Compound Q&A

How should 5-Quinoxalinesulfonyl chloride (CAS: 844646-88-4) be stored?

5-Quinoxalinesulfonyl chloride should be stored in a cool, dry place away from direct sunlight and h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...