Compound Q&A

What is 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4)?

Answer

5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid
5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4) is a chemical compound with a molecular structure that includes a bromophenyl group, a methyl substituent, and a carboxylic acid functional group. This compound is typically white or off-white in color and has a molecular formula of C13H10BrNO2. It is used in various applications, including pharmaceuticals and research.

About

CAS No 91182-60-4
English Name 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid
Molecular Formula C11H8BrNO3
Molecular Weight 282.09 g/mol
SMILES CC1=NOC(=C1C(=O)O)C2=CC=C(C=C2)Br
InChIKey GFLKZFOUAHOGJF-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What are the main uses of 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4)?

5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4) is primarily used in pharmac...

Compound Q&A

Is 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4) safe?

5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4) is generally safe when handl...

Compound Q&A

How should 5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4) be stored?

5-(4-Bromophenyl)-3-methylisoxazole-4-carboxylic acid (CAS: 91182-60-4) should be stored in a tightl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...