Compound Q&A

What is 1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5)?

Answer

1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene
1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5) is a complex organic compound with a unique structure. It contains three phenyl rings connected by a benzene ring, each bearing a 4-(dihydroxyboryl) group. This compound is characterized by its stability and reactivity in various chemical reactions.

About

English Name 1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene
Molecular Formula C24H21B3O6
Molecular Weight 437.86 g/mol
SMILES B(C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)B(O)O)C4=CC=C(C=C4)B(O)O)(O)O
InChIKey AKXLLRRTTCMCOZ-UHFFFAOYSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What are the main uses of 1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5)?

1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5) is primarily used in pharmaceutical r...

Compound Q&A

Is 1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5) safe?

1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5) is generally considered safe for labo...

Compound Q&A

How should 1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5) be stored?

1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (CAS: 900795-73-5) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...