Compound Q&A

How should (2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-54-6) be stored?

Answer

(2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid
(2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid should be stored in a cool, dry place away from direct sunlight and sources of heat. It should be kept in a tightly closed container to protect it from moisture and air. The storage temperature should not exceed 25°C. The compound is highly sensitive to moisture, so it is crucial to maintain a dry environment and use desiccants if necessary. Adequate ventilation should be provided during storage and handling to ensure safety and prevent the formation of potentially hazardous conditions.

About

CAS No 70918-54-6
English Name (2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid
Molecular Formula C9H8O4
Molecular Weight 180.16 g/mol
SMILES C1C(OC2=CC=CC=C2O1)C(=O)O
InChIKey HMBHAQMOBKLWRX-QMMMGPOBSA-N
Last Updated: 2025-10-27 20:22

Related Q&A

Compound Q&A

What is (2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-54-6)?

(2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid, also known as 2,3-dihydro-1,4-benzodioxine-2-ca...

Compound Q&A

What are the main uses of (2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-54-6)?

(2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid is primarily used as a precursor in the synthesi...

Compound Q&A

Is (2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid (CAS: 70918-54-6) safe?

(2S)-2,3-Dihydro-1,4-benzodioxine-2-carboxylic acid, while it is generally safe when handled correct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...