Compound Q&A

What are the main uses of 2,3-Difluoro-1-methoxy-4-nitrobenzene (CAS: 66684-59-1)?

Answer

2,3-Difluoro-1-methoxy-4-nitrobenzene
2,3-Difluoro-1-methoxy-4-nitrobenzene is primarily used in the pharmaceutical and research industries as an intermediate for the synthesis of drug molecules. It also serves as a reagent in organic synthesis due to its reactivity and unique functional groups.

About

CAS No 66684-59-1
English Name 2,3-Difluoro-1-methoxy-4-nitrobenzene
Molecular Formula C7H5F2NO3
Molecular Weight 189.12 g/mol
SMILES COC1=C(C(=C(C=C1)[N+](=O)[O-])F)F
InChIKey KDXIYOKCZFOFOR-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is 2,3-Difluoro-1-methoxy-4-nitrobenzene (CAS: 66684-59-1)?

2,3-Difluoro-1-methoxy-4-nitrobenzene is an aromatic organic compound with the formula C8H6FN2O2. It...

Compound Q&A

Is 2,3-Difluoro-1-methoxy-4-nitrobenzene (CAS: 66684-59-1) safe?

2,3-Difluoro-1-methoxy-4-nitrobenzene can be handled with appropriate safety precautions. It is impo...

Compound Q&A

How should 2,3-Difluoro-1-methoxy-4-nitrobenzene (CAS: 66684-59-1) be stored?

2,3-Difluoro-1-methoxy-4-nitrobenzene should be stored in a cool, dry environment to maintain its st...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...