Compound Q&A

How should 3,5-Dichloro-4-fluorobenzoic acid (CAS: 98191-30-1) be stored?

Answer

3,5-Dichloro-4-fluorobenzoic acid
3,5-Dichloro-4-fluorobenzoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and light exposure. Proper storage conditions help maintain its stability and prevent degradation.

About

CAS No 98191-30-1
English Name 3,5-Dichloro-4-fluorobenzoic acid
Molecular Formula C7H3Cl2FO2
Molecular Weight 209 g/mol
SMILES C1=C(C=C(C(=C1Cl)F)Cl)C(=O)O
InChIKey CRRHVMZOOBWYRG-UHFFFAOYSA-N
Last Updated: 2025-10-27 13:14

Related Q&A

Compound Q&A

What is 3,5-Dichloro-4-fluorobenzoic acid (CAS: 98191-30-1)?

3,5-Dichloro-4-fluorobenzoic acid is an organic compound with the CAS number 98191-30-1. It has the ...

Compound Q&A

What are the main uses of 3,5-Dichloro-4-fluorobenzoic acid (CAS: 98191-30-1)?

3,5-Dichloro-4-fluorobenzoic acid is primarily used in the pharmaceutical and chemical industries. I...

Compound Q&A

Is 3,5-Dichloro-4-fluorobenzoic acid (CAS: 98191-30-1) safe?

3,5-Dichloro-4-fluorobenzoic acid is generally considered safe when handled with appropriate precaut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...